C18H25F3N8O2 — CID 175843343
bis(2-[(4-aminophenyl)methyl]guanidine);2,2,2-trifluoroacetic acid (PubChem CID 175843343) has the molecular formula C18H25F3N8O2 and a molecular weight of 442.45 g/mol. Its IUPAC name is bis(2-[(4-aminophenyl)methyl]guanidine);2,2,2-trifluoroacetic acid.
| Compound Name | bis(2-[(4-aminophenyl)methyl]guanidine);2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175843343 |
| Molecular Formula | C18H25F3N8O2 |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | bis(2-[(4-aminophenyl)methyl]guanidine);2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=NCc1ccc(N)cc1.NC(N)=NCc1ccc(N)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/2C8H12N4.C2HF3O2/c2*9-7-3-1-6(2-4-7)5-12-8(10)11;3-2(4,5)1(6)7/h2*1-4H,5,9H2,(H4,10,11,12);(H,6,7) |
| InChIKey | BHDUBRCQWYFIBP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 218.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|