About 2-cyclohexyl-3,3a-dihydro-2H-furo[3,2-b]pyran
2-cyclohexyl-3,3a-dihydro-2H-furo[3,2-b]pyran (PubChem CID 175844194) has the molecular formula C13H18O2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-cyclohexyl-3,3a-dihydro-2H-furo[3,2-b]pyran.
Molecular Properties
| Compound Name | 2-cyclohexyl-3,3a-dihydro-2H-furo[3,2-b]pyran |
| PubChem CID | 175844194 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-cyclohexyl-3,3a-dihydro-2H-furo[3,2-b]pyran |
| SMILES | C1=COC2CC(C3CCCCC3)OC2=C1 |
| InChI | InChI=1S/C13H18O2/c1-2-5-10(6-3-1)12-9-13-11(15-12)7-4-8-14-13/h4,7-8,10,12-13H,1-3,5-6,9H2 |
| InChIKey | JAHRXIAAOBKGBB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexyl-3,3a-dihydro-2H-furo[3,2-b]pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-3,3a-dihydro-2H-furo[3,2-b]pyran?
The IUPAC name of 2-cyclohexyl-3,3a-dihydro-2H-furo[3,2-b]pyran (CID 175844194) is 2-cyclohexyl-3,3a-dihydro-2H-furo[3,2-b]pyran.
What is the SMILES notation for 2-cyclohexyl-3,3a-dihydro-2H-furo[3,2-b]pyran?
The canonical SMILES for 2-cyclohexyl-3,3a-dihydro-2H-furo[3,2-b]pyran is C1=COC2CC(C3CCCCC3)OC2=C1.
What is the InChIKey of 2-cyclohexyl-3,3a-dihydro-2H-furo[3,2-b]pyran?
The InChIKey is JAHRXIAAOBKGBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-2-5-10(6-3-1)12-9-13-11(15-12)7-4-8-14-13/h4,7-8,10,12-13H,1-3,5-6,9H2.
What are the key properties of 2-cyclohexyl-3,3a-dihydro-2H-furo[3,2-b]pyran?
2-cyclohexyl-3,3a-dihydro-2H-furo[3,2-b]pyran has a molecular weight of 206.29 g/mol, XLogP of 3.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-3,3a-dihydro-2H-furo[3,2-b]pyran is sourced from PubChem (CID 175844194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).