C11H19N3O8S2 — CID 175844318
[(2S,5R)-2-[tert-butylsulfonyl(formyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 175844318) has the molecular formula C11H19N3O8S2 and a molecular weight of 385.42 g/mol. Its IUPAC name is [(2S,5R)-2-[tert-butylsulfonyl(formyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[tert-butylsulfonyl(formyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 175844318 |
| Molecular Formula | C11H19N3O8S2 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | [(2S,5R)-2-[tert-butylsulfonyl(formyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CC(C)(C)S(=O)(=O)N(C=O)[C@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C11H19N3O8S2/c1-11(2,3)23(17,18)13(7-15)9-5-4-8-6-12(9)10(16)14(8)22-24(19,20)21/h7-9H,4-6H2,1-3H3,(H,19,20,21)/t8-,9+/m1/s1 |
| InChIKey | YMJNDWXDERXXQE-BDAKNGLRSA-N |
| XLogP | -0.47 |
| TPSA | 141.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|