C10H14N3NaO8S2 — CID 175844333
sodium [(2S,5R)-2-[cyclopropylsulfonyl(formyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 175844333) has the molecular formula C10H14N3NaO8S2 and a molecular weight of 391.36 g/mol. Its IUPAC name is sodium [(2S,5R)-2-[cyclopropylsulfonyl(formyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-2-[cyclopropylsulfonyl(formyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 175844333 |
| Molecular Formula | C10H14N3NaO8S2 |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | sodium [(2S,5R)-2-[cyclopropylsulfonyl(formyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | O=CN([C@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-])S(=O)(=O)C1CC1.[Na+] |
| InChI | InChI=1S/C10H15N3O8S2.Na/c14-6-12(22(16,17)8-2-3-8)9-4-1-7-5-11(9)10(15)13(7)21-23(18,19)20;/h6-9H,1-5H2,(H,18,19,20);/q;+1/p-1/t7-,9+;/m1./s1 |
| InChIKey | MXHLQKFVXOSHOD-JXLXBRSFSA-M |
| XLogP | -4.44 |
| TPSA | 144.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | -4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|