About 5-[5-(difluoromethyl)-4,6-dimorpholin-4-ylpyrimidin-2-yl]pyrimidin-2-amine
5-[5-(difluoromethyl)-4,6-dimorpholin-4-ylpyrimidin-2-yl]pyrimidin-2-amine (PubChem CID 175844623) has the molecular formula C17H21F2N7O2
and a molecular weight of 393.40 g/mol. Its IUPAC name is 5-[5-(difluoromethyl)-4,6-dimorpholin-4-ylpyrimidin-2-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-[5-(difluoromethyl)-4,6-dimorpholin-4-ylpyrimidin-2-yl]pyrimidin-2-amine |
| PubChem CID | 175844623 |
| Molecular Formula | C17H21F2N7O2 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 5-[5-(difluoromethyl)-4,6-dimorpholin-4-ylpyrimidin-2-yl]pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)c(C(F)F)c(N3CCOCC3)n2)cn1 |
| InChI | InChI=1S/C17H21F2N7O2/c18-13(19)12-15(25-1-5-27-6-2-25)23-14(11-9-21-17(20)22-10-11)24-16(12)26-3-7-28-8-4-26/h9-10,13H,1-8H2,(H2,20,21,22) |
| InChIKey | IFIGFPISHLNDGV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 5-[5-(difluoromethyl)-4,6-dimorpholin-4-ylpyrimidin-2-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(difluoromethyl)-4,6-dimorpholin-4-ylpyrimidin-2-yl]pyrimidin-2-amine?
The IUPAC name of 5-[5-(difluoromethyl)-4,6-dimorpholin-4-ylpyrimidin-2-yl]pyrimidin-2-amine (CID 175844623) is 5-[5-(difluoromethyl)-4,6-dimorpholin-4-ylpyrimidin-2-yl]pyrimidin-2-amine.
What is the SMILES notation for 5-[5-(difluoromethyl)-4,6-dimorpholin-4-ylpyrimidin-2-yl]pyrimidin-2-amine?
The canonical SMILES for 5-[5-(difluoromethyl)-4,6-dimorpholin-4-ylpyrimidin-2-yl]pyrimidin-2-amine is Nc1ncc(-c2nc(N3CCOCC3)c(C(F)F)c(N3CCOCC3)n2)cn1.
What is the InChIKey of 5-[5-(difluoromethyl)-4,6-dimorpholin-4-ylpyrimidin-2-yl]pyrimidin-2-amine?
The InChIKey is IFIGFPISHLNDGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2N7O2/c18-13(19)12-15(25-1-5-27-6-2-25)23-14(11-9-21-17(20)22-10-11)24-16(12)26-3-7-28-8-4-26/h9-10,13H,1-8H2,(H2,20,21,22).
What are the key properties of 5-[5-(difluoromethyl)-4,6-dimorpholin-4-ylpyrimidin-2-yl]pyrimidin-2-amine?
5-[5-(difluoromethyl)-4,6-dimorpholin-4-ylpyrimidin-2-yl]pyrimidin-2-amine has a molecular weight of 393.40 g/mol, XLogP of 1.13, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(difluoromethyl)-4,6-dimorpholin-4-ylpyrimidin-2-yl]pyrimidin-2-amine is sourced from PubChem (CID 175844623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).