C16H16F2N4O3S — CID 175845400
2-[12-(difluoromethyl)-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl]-N-(1-hydroxy-3-methylcyclobutyl)acetamide (PubChem CID 175845400) has the molecular formula C16H16F2N4O3S and a molecular weight of 382.39 g/mol. Its IUPAC name is 2-[12-(difluoromethyl)-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl]-N-(1-hydroxy-3-methylcyclobutyl)acetamide.
| Compound Name | 2-[12-(difluoromethyl)-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl]-N-(1-hydroxy-3-methylcyclobutyl)acetamide |
|---|---|
| PubChem CID | 175845400 |
| Molecular Formula | C16H16F2N4O3S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 2-[12-(difluoromethyl)-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl]-N-(1-hydroxy-3-methylcyclobutyl)acetamide |
| SMILES | CC1CC(O)(NC(=O)Cn2nc(C(F)F)n3c(cc4sccc43)c2=O)C1 |
| InChI | InChI=1S/C16H16F2N4O3S/c1-8-5-16(25,6-8)19-12(23)7-21-15(24)10-4-11-9(2-3-26-11)22(10)14(20-21)13(17)18/h2-4,8,13,25H,5-7H2,1H3,(H,19,23) |
| InChIKey | RWNMDJOBJYNWQR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 88.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|