C19H19FeN5O2 — CID 175845402
iron;1-methyl-3-N-(6-spiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yloxy-3-pyridinyl)pyrazole-3,4-diamine (PubChem CID 175845402) has the molecular formula C19H19FeN5O2 and a molecular weight of 405.24 g/mol. Its IUPAC name is iron;1-methyl-3-N-(6-spiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yloxy-3-pyridinyl)pyrazole-3,4-diamine.
| Compound Name | iron;1-methyl-3-N-(6-spiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yloxy-3-pyridinyl)pyrazole-3,4-diamine |
|---|---|
| PubChem CID | 175845402 |
| Molecular Formula | C19H19FeN5O2 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | iron;1-methyl-3-N-(6-spiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yloxy-3-pyridinyl)pyrazole-3,4-diamine |
| SMILES | Cn1cc(N)c(Nc2ccc(Oc3cccc4c3C3(CC3)CO4)nc2)n1.[Fe] |
| InChI | InChI=1S/C19H19N5O2.Fe/c1-24-10-13(20)18(23-24)22-12-5-6-16(21-9-12)26-15-4-2-3-14-17(15)19(7-8-19)11-25-14;/h2-6,9-10H,7-8,11,20H2,1H3,(H,22,23); |
| InChIKey | RJFDGTFSLSCIFX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|