C53H60BrN2O6P — CID 175845753
6-[[3,4-bis(phenylmethoxy)phenoxy]carbonyl-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]amino]hexyl-triphenylphosphanium bromide (PubChem CID 175845753) has the molecular formula C53H60BrN2O6P and a molecular weight of 931.95 g/mol. Its IUPAC name is 6-[[3,4-bis(phenylmethoxy)phenoxy]carbonyl-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]amino]hexyl-triphenylphosphanium bromide.
| Compound Name | 6-[[3,4-bis(phenylmethoxy)phenoxy]carbonyl-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]amino]hexyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 175845753 |
| Molecular Formula | C53H60BrN2O6P |
| Molecular Weight | 931.95 g/mol |
| Exact Mass | 930.34 |
| IUPAC Name | 6-[[3,4-bis(phenylmethoxy)phenoxy]carbonyl-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]amino]hexyl-triphenylphosphanium bromide |
| SMILES | CN(CCN(CCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)Oc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1)C(=O)OC(C)(C)C.[Br-] |
| InChI | InChI=1S/C53H60N2O6P.BrH/c1-53(2,3)61-51(56)54(4)37-38-55(36-22-5-6-23-39-62(46-28-16-9-17-29-46,47-30-18-10-19-31-47)48-32-20-11-21-33-48)52(57)60-45-34-35-49(58-41-43-24-12-7-13-25-43)50(40-45)59-42-44-26-14-8-15-27-44;/h7-21,24-35,40H,5-6,22-23,36-39,41-42H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | MRVDAINKMCYZSB-UHFFFAOYSA-M |
| XLogP | 8.07 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.95 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|