About dioctyl hexanedioate;methane
dioctyl hexanedioate;methane (PubChem CID 175846314) has the molecular formula C23H46O4
and a molecular weight of 386.62 g/mol. Its IUPAC name is dioctyl hexanedioate;methane.
Molecular Properties
| Compound Name | dioctyl hexanedioate;methane |
| PubChem CID | 175846314 |
| Molecular Formula | C23H46O4 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.34 |
| IUPAC Name | dioctyl hexanedioate;methane |
| SMILES | C.CCCCCCCCOC(=O)CCCCC(=O)OCCCCCCCC |
| InChI | InChI=1S/C22H42O4.CH4/c1-3-5-7-9-11-15-19-25-21(23)17-13-14-18-22(24)26-20-16-12-10-8-6-4-2;/h3-20H2,1-2H3;1H4 |
| InChIKey | KCZFMGOZKLDBFN-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dioctyl hexanedioate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioctyl hexanedioate;methane?
The IUPAC name of dioctyl hexanedioate;methane (CID 175846314) is dioctyl hexanedioate;methane.
What is the SMILES notation for dioctyl hexanedioate;methane?
The canonical SMILES for dioctyl hexanedioate;methane is C.CCCCCCCCOC(=O)CCCCC(=O)OCCCCCCCC.
What is the InChIKey of dioctyl hexanedioate;methane?
The InChIKey is KCZFMGOZKLDBFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O4.CH4/c1-3-5-7-9-11-15-19-25-21(23)17-13-14-18-22(24)26-20-16-12-10-8-6-4-2;/h3-20H2,1-2H3;1H4.
What are the key properties of dioctyl hexanedioate;methane?
dioctyl hexanedioate;methane has a molecular weight of 386.62 g/mol, XLogP of 6.99, 19 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dioctyl hexanedioate;methane is sourced from PubChem (CID 175846314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).