C21H23F3N6O5S — CID 175846464
4-N-ethyl-2-N-(5-morpholin-2-ylsulfonyl-2,3-dihydro-1,4-benzodioxin-8-yl)-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 175846464) has the molecular formula C21H23F3N6O5S and a molecular weight of 528.51 g/mol. Its IUPAC name is 4-N-ethyl-2-N-(5-morpholin-2-ylsulfonyl-2,3-dihydro-1,4-benzodioxin-8-yl)-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-ethyl-2-N-(5-morpholin-2-ylsulfonyl-2,3-dihydro-1,4-benzodioxin-8-yl)-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 175846464 |
| Molecular Formula | C21H23F3N6O5S |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 4-N-ethyl-2-N-(5-morpholin-2-ylsulfonyl-2,3-dihydro-1,4-benzodioxin-8-yl)-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CCNc1nc(Nc2ccc(S(=O)(=O)C3CNCCO3)c3c2OCCO3)nc2[nH]cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C21H23F3N6O5S/c1-2-26-18-15-11(21(22,23)24)9-27-19(15)30-20(29-18)28-12-3-4-13(17-16(12)34-7-8-35-17)36(31,32)14-10-25-5-6-33-14/h3-4,9,14,25H,2,5-8,10H2,1H3,(H3,26,27,28,29,30) |
| InChIKey | RJRNFHZARZRGGQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 139.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |