About [4-methyl-5-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]urea
[4-methyl-5-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]urea (PubChem CID 175846540) has the molecular formula C10H12N6OS
and a molecular weight of 264.31 g/mol. Its IUPAC name is [4-methyl-5-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]urea.
Molecular Properties
| Compound Name | [4-methyl-5-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]urea |
| PubChem CID | 175846540 |
| Molecular Formula | C10H12N6OS |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | [4-methyl-5-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]urea |
| SMILES | CNc1nccc(-c2sc(NC(N)=O)nc2C)n1 |
| InChI | InChI=1S/C10H12N6OS/c1-5-7(18-10(14-5)16-8(11)17)6-3-4-13-9(12-2)15-6/h3-4H,1-2H3,(H,12,13,15)(H3,11,14,16,17) |
| InChIKey | IPILAUJYWGMPKO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-methyl-5-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methyl-5-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]urea?
The IUPAC name of [4-methyl-5-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]urea (CID 175846540) is [4-methyl-5-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]urea.
What is the SMILES notation for [4-methyl-5-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]urea?
The canonical SMILES for [4-methyl-5-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]urea is CNc1nccc(-c2sc(NC(N)=O)nc2C)n1.
What is the InChIKey of [4-methyl-5-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]urea?
The InChIKey is IPILAUJYWGMPKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N6OS/c1-5-7(18-10(14-5)16-8(11)17)6-3-4-13-9(12-2)15-6/h3-4H,1-2H3,(H,12,13,15)(H3,11,14,16,17).
What are the key properties of [4-methyl-5-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]urea?
[4-methyl-5-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]urea has a molecular weight of 264.31 g/mol, XLogP of 1.44, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methyl-5-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]urea is sourced from PubChem (CID 175846540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).