About CID 175846634
CID 175846634 (PubChem CID 175846634) has the molecular formula C9H13BN
and a molecular weight of 146.02 g/mol.
Molecular Properties
| Compound Name | CID 175846634 |
| PubChem CID | 175846634 |
| Molecular Formula | C9H13BN |
| Molecular Weight | 146.02 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | — |
| SMILES | [B]1CCCC1C1=NC=CCC1 |
| InChI | InChI=1S/C9H13BN/c1-2-7-11-9(5-1)8-4-3-6-10-8/h2,7-8H,1,3-6H2 |
| InChIKey | RMKREKINBJLNPA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.02 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175846634 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175846634?
The IUPAC name of CID 175846634 (CID 175846634) is not available.
What is the SMILES notation for CID 175846634?
The canonical SMILES for CID 175846634 is [B]1CCCC1C1=NC=CCC1.
What is the InChIKey of CID 175846634?
The InChIKey is RMKREKINBJLNPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BN/c1-2-7-11-9(5-1)8-4-3-6-10-8/h2,7-8H,1,3-6H2.
What are the key properties of CID 175846634?
CID 175846634 has a molecular weight of 146.02 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175846634 is sourced from PubChem (CID 175846634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).