About (5-arsanyl-1,3,3-trimethylcyclohexyl)methanamine
(5-arsanyl-1,3,3-trimethylcyclohexyl)methanamine (PubChem CID 175846791) has the molecular formula C10H22AsN
and a molecular weight of 231.21 g/mol. Its IUPAC name is (5-arsanyl-1,3,3-trimethylcyclohexyl)methanamine.
Molecular Properties
| Compound Name | (5-arsanyl-1,3,3-trimethylcyclohexyl)methanamine |
| PubChem CID | 175846791 |
| Molecular Formula | C10H22AsN |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | (5-arsanyl-1,3,3-trimethylcyclohexyl)methanamine |
| SMILES | CC1(C)CC([AsH2])CC(C)(CN)C1 |
| InChI | InChI=1S/C10H22AsN/c1-9(2)4-8(11)5-10(3,6-9)7-12/h8H,4-7,11-12H2,1-3H3 |
| InChIKey | YUAODNZXWSPNIW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (5-arsanyl-1,3,3-trimethylcyclohexyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-arsanyl-1,3,3-trimethylcyclohexyl)methanamine?
The IUPAC name of (5-arsanyl-1,3,3-trimethylcyclohexyl)methanamine (CID 175846791) is (5-arsanyl-1,3,3-trimethylcyclohexyl)methanamine.
What is the SMILES notation for (5-arsanyl-1,3,3-trimethylcyclohexyl)methanamine?
The canonical SMILES for (5-arsanyl-1,3,3-trimethylcyclohexyl)methanamine is CC1(C)CC([AsH2])CC(C)(CN)C1.
What is the InChIKey of (5-arsanyl-1,3,3-trimethylcyclohexyl)methanamine?
The InChIKey is YUAODNZXWSPNIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22AsN/c1-9(2)4-8(11)5-10(3,6-9)7-12/h8H,4-7,11-12H2,1-3H3.
What are the key properties of (5-arsanyl-1,3,3-trimethylcyclohexyl)methanamine?
(5-arsanyl-1,3,3-trimethylcyclohexyl)methanamine has a molecular weight of 231.21 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5-arsanyl-1,3,3-trimethylcyclohexyl)methanamine is sourced from PubChem (CID 175846791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).