C20H22N4 — CID 175847129
2,3-bis(4-aminophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 175847129) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2,3-bis(4-aminophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 2,3-bis(4-aminophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 175847129 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2,3-bis(4-aminophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | CNc1ccc(NC)c(-c2ccc(N)cc2)c1-c1ccc(N)cc1 |
| InChI | InChI=1S/C20H22N4/c1-23-17-11-12-18(24-2)20(14-5-9-16(22)10-6-14)19(17)13-3-7-15(21)8-4-13/h3-12,23-24H,21-22H2,1-2H3 |
| InChIKey | KSWXXOROWCEVOO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|