C6H3N11O4 — CID 175847416
7,8-dinitro-3-(2H-tetrazol-5-yl)pyrazolo[5,1-c][1,2,4]triazin-4-amine (PubChem CID 175847416) has the molecular formula C6H3N11O4 and a molecular weight of 293.16 g/mol. Its IUPAC name is 7,8-dinitro-3-(2H-tetrazol-5-yl)pyrazolo[5,1-c][1,2,4]triazin-4-amine.
| Compound Name | 7,8-dinitro-3-(2H-tetrazol-5-yl)pyrazolo[5,1-c][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 175847416 |
| Molecular Formula | C6H3N11O4 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 7,8-dinitro-3-(2H-tetrazol-5-yl)pyrazolo[5,1-c][1,2,4]triazin-4-amine |
| SMILES | Nc1c(-c2nn[nH]n2)nnc2c([N+](=O)[O-])c([N+](=O)[O-])nn12 |
| InChI | InChI=1S/C6H3N11O4/c7-3-1(4-9-13-14-10-4)8-11-5-2(16(18)19)6(17(20)21)12-15(3)5/h7H2,(H,9,10,13,14) |
| InChIKey | HSVTYROKGWAYFJ-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 209.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|