C25H26F2O3 — CID 175847730
[(1R,6R)-6-(2,5-difluorophenyl)-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-(2,6-dihydroxyphenyl)methanone (PubChem CID 175847730) has the molecular formula C25H26F2O3 and a molecular weight of 412.48 g/mol. Its IUPAC name is [(1R,6R)-6-(2,5-difluorophenyl)-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-(2,6-dihydroxyphenyl)methanone.
| Compound Name | [(1R,6R)-6-(2,5-difluorophenyl)-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-(2,6-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 175847730 |
| Molecular Formula | C25H26F2O3 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | [(1R,6R)-6-(2,5-difluorophenyl)-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-(2,6-dihydroxyphenyl)methanone |
| SMILES | CC(C)=CCCC1=CC[C@@H](C(=O)c2c(O)cccc2O)[C@H](c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C25H26F2O3/c1-15(2)5-3-6-16-9-11-18(25(30)24-22(28)7-4-8-23(24)29)19(13-16)20-14-17(26)10-12-21(20)27/h4-5,7-10,12,14,18-19,28-29H,3,6,11,13H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | FALCUYNMBWGWAG-RTBURBONSA-N |
| XLogP | 6.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|