C14H19F3N2O3 — CID 175847795
(2S)-2-acetamidopropanoic acid;(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethanamine (PubChem CID 175847795) has the molecular formula C14H19F3N2O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is (2S)-2-acetamidopropanoic acid;(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethanamine.
| Compound Name | (2S)-2-acetamidopropanoic acid;(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethanamine |
|---|---|
| PubChem CID | 175847795 |
| Molecular Formula | C14H19F3N2O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (2S)-2-acetamidopropanoic acid;(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethanamine |
| SMILES | CC(=O)N[C@@H](C)C(=O)O.C[C@@H](N)c1cccc(C(F)F)c1F |
| InChI | InChI=1S/C9H10F3N.C5H9NO3/c1-5(13)6-3-2-4-7(8(6)10)9(11)12;1-3(5(8)9)6-4(2)7/h2-5,9H,13H2,1H3;3H,1-2H3,(H,6,7)(H,8,9)/t5-;3-/m10/s1 |
| InChIKey | HNDLNLGKERUHCK-XMZRBHTFSA-N |
| XLogP | 2.38 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |