C27H32O3 — CID 175847800
(2,6-dimethoxyphenyl)-[(1R,6R)-4-(4-methylpent-3-enyl)-6-phenylcyclohex-3-en-1-yl]methanone (PubChem CID 175847800) has the molecular formula C27H32O3 and a molecular weight of 404.55 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl)-[(1R,6R)-4-(4-methylpent-3-enyl)-6-phenylcyclohex-3-en-1-yl]methanone.
| Compound Name | (2,6-dimethoxyphenyl)-[(1R,6R)-4-(4-methylpent-3-enyl)-6-phenylcyclohex-3-en-1-yl]methanone |
|---|---|
| PubChem CID | 175847800 |
| Molecular Formula | C27H32O3 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | (2,6-dimethoxyphenyl)-[(1R,6R)-4-(4-methylpent-3-enyl)-6-phenylcyclohex-3-en-1-yl]methanone |
| SMILES | COc1cccc(OC)c1C(=O)[C@@H]1CC=C(CCC=C(C)C)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H32O3/c1-19(2)10-8-11-20-16-17-22(23(18-20)21-12-6-5-7-13-21)27(28)26-24(29-3)14-9-15-25(26)30-4/h5-7,9-10,12-16,22-23H,8,11,17-18H2,1-4H3/t22-,23+/m1/s1 |
| InChIKey | DDWHBOWGKNOXIQ-PKTZIBPZSA-N |
| XLogP | 6.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|