About [3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]carbamic acid
[3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]carbamic acid (PubChem CID 175847966) has the molecular formula C7H8F3N3O2
and a molecular weight of 223.15 g/mol. Its IUPAC name is [3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]carbamic acid.
Analyze [3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]carbamic acid?
The IUPAC name of [3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]carbamic acid (CID 175847966) is [3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]carbamic acid.
What is the SMILES notation for [3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]carbamic acid?
The canonical SMILES for [3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]carbamic acid is Cc1nn(CC(F)(F)F)cc1NC(=O)O.
What is the InChIKey of [3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]carbamic acid?
The InChIKey is AJCYWUQZYOPMHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3N3O2/c1-4-5(11-6(14)15)2-13(12-4)3-7(8,9)10/h2,11H,3H2,1H3,(H,14,15).
What are the key properties of [3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]carbamic acid?
[3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]carbamic acid has a molecular weight of 223.15 g/mol, XLogP of 1.84, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]carbamic acid is sourced from PubChem (CID 175847966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).