C25H25Cl2N5O — CID 175848367
N-[(3-chlorophenyl)methyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-(1,2,3,6-tetrahydropyridin-4-yl)quinazolin-4-amine;hydrochloride (PubChem CID 175848367) has the molecular formula C25H25Cl2N5O and a molecular weight of 482.42 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-(1,2,3,6-tetrahydropyridin-4-yl)quinazolin-4-amine;hydrochloride.
| Compound Name | N-[(3-chlorophenyl)methyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-(1,2,3,6-tetrahydropyridin-4-yl)quinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 175848367 |
| Molecular Formula | C25H25Cl2N5O |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-(1,2,3,6-tetrahydropyridin-4-yl)quinazolin-4-amine;hydrochloride |
| SMILES | Cc1noc(C)c1-c1ccc2nc(C3=CCNCC3)nc(NCc3cccc(Cl)c3)c2c1.Cl |
| InChI | InChI=1S/C25H24ClN5O.ClH/c1-15-23(16(2)32-31-15)19-6-7-22-21(13-19)25(28-14-17-4-3-5-20(26)12-17)30-24(29-22)18-8-10-27-11-9-18;/h3-8,12-13,27H,9-11,14H2,1-2H3,(H,28,29,30);1H |
| InChIKey | YGQCASKXZXAMDU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |