About 2-(aminomethyl)-N,N-dimethyl-1,3-benzothiazol-5-amine;hydrochloride
2-(aminomethyl)-N,N-dimethyl-1,3-benzothiazol-5-amine;hydrochloride (PubChem CID 175848519) has the molecular formula C10H14ClN3S
and a molecular weight of 243.76 g/mol. Its IUPAC name is 2-(aminomethyl)-N,N-dimethyl-1,3-benzothiazol-5-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-(aminomethyl)-N,N-dimethyl-1,3-benzothiazol-5-amine;hydrochloride |
| PubChem CID | 175848519 |
| Molecular Formula | C10H14ClN3S |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-(aminomethyl)-N,N-dimethyl-1,3-benzothiazol-5-amine;hydrochloride |
| SMILES | CN(C)c1ccc2sc(CN)nc2c1.Cl |
| InChI | InChI=1S/C10H13N3S.ClH/c1-13(2)7-3-4-9-8(5-7)12-10(6-11)14-9;/h3-5H,6,11H2,1-2H3;1H |
| InChIKey | YQMRBKSZYICTCX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(aminomethyl)-N,N-dimethyl-1,3-benzothiazol-5-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-N,N-dimethyl-1,3-benzothiazol-5-amine;hydrochloride?
The IUPAC name of 2-(aminomethyl)-N,N-dimethyl-1,3-benzothiazol-5-amine;hydrochloride (CID 175848519) is 2-(aminomethyl)-N,N-dimethyl-1,3-benzothiazol-5-amine;hydrochloride.
What is the SMILES notation for 2-(aminomethyl)-N,N-dimethyl-1,3-benzothiazol-5-amine;hydrochloride?
The canonical SMILES for 2-(aminomethyl)-N,N-dimethyl-1,3-benzothiazol-5-amine;hydrochloride is CN(C)c1ccc2sc(CN)nc2c1.Cl.
What is the InChIKey of 2-(aminomethyl)-N,N-dimethyl-1,3-benzothiazol-5-amine;hydrochloride?
The InChIKey is YQMRBKSZYICTCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3S.ClH/c1-13(2)7-3-4-9-8(5-7)12-10(6-11)14-9;/h3-5H,6,11H2,1-2H3;1H.
What are the key properties of 2-(aminomethyl)-N,N-dimethyl-1,3-benzothiazol-5-amine;hydrochloride?
2-(aminomethyl)-N,N-dimethyl-1,3-benzothiazol-5-amine;hydrochloride has a molecular weight of 243.76 g/mol, XLogP of 2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-N,N-dimethyl-1,3-benzothiazol-5-amine;hydrochloride is sourced from PubChem (CID 175848519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).