About CID 175849131
CID 175849131 (PubChem CID 175849131) has the molecular formula C4H5AsN3O
and a molecular weight of 186.03 g/mol.
Molecular Properties
| Compound Name | CID 175849131 |
| PubChem CID | 175849131 |
| Molecular Formula | C4H5AsN3O |
| Molecular Weight | 186.03 g/mol |
| Exact Mass | 185.96 |
| IUPAC Name | — |
| SMILES | Nc1ccnc(=O)[nH]1.[As] |
| InChI | InChI=1S/C4H5N3O.As/c5-3-1-2-6-4(8)7-3;/h1-2H,(H3,5,6,7,8); |
| InChIKey | CCQSSDWPWNBPNT-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.03 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175849131 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175849131?
The IUPAC name of CID 175849131 (CID 175849131) is not available.
What is the SMILES notation for CID 175849131?
The canonical SMILES for CID 175849131 is Nc1ccnc(=O)[nH]1.[As].
What is the InChIKey of CID 175849131?
The InChIKey is CCQSSDWPWNBPNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O.As/c5-3-1-2-6-4(8)7-3;/h1-2H,(H3,5,6,7,8);.
What are the key properties of CID 175849131?
CID 175849131 has a molecular weight of 186.03 g/mol, XLogP of -1.03, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175849131 is sourced from PubChem (CID 175849131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).