C10H18N4 — CID 175849285
4-deuterio-4-[(2R,5R)-2,5-dimethylpiperazin-1-yl]-1H-pyrimidine (PubChem CID 175849285) has the molecular formula C10H18N4 and a molecular weight of 195.29 g/mol. Its IUPAC name is 4-deuterio-4-[(2R,5R)-2,5-dimethylpiperazin-1-yl]-1H-pyrimidine.
| Compound Name | 4-deuterio-4-[(2R,5R)-2,5-dimethylpiperazin-1-yl]-1H-pyrimidine |
|---|---|
| PubChem CID | 175849285 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 4-deuterio-4-[(2R,5R)-2,5-dimethylpiperazin-1-yl]-1H-pyrimidine |
| SMILES | [2H]C1(N2C[C@@H](C)NC[C@H]2C)C=CNC=N1 |
| InChI | InChI=1S/C10H18N4/c1-8-6-14(9(2)5-12-8)10-3-4-11-7-13-10/h3-4,7-10,12H,5-6H2,1-2H3,(H,11,13)/t8-,9-,10?/m1/s1/i10D |
| InChIKey | PKFLISNQBAXGGD-JVAPGIPWSA-N |
| XLogP | 0.14 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |