About 2-ethyl-1-nonylpiperidine;hydrofluoride
2-ethyl-1-nonylpiperidine;hydrofluoride (PubChem CID 175849535) has the molecular formula C16H34FN
and a molecular weight of 259.45 g/mol. Its IUPAC name is 2-ethyl-1-nonylpiperidine;hydrofluoride.
Molecular Properties
| Compound Name | 2-ethyl-1-nonylpiperidine;hydrofluoride |
| PubChem CID | 175849535 |
| Molecular Formula | C16H34FN |
| Molecular Weight | 259.45 g/mol |
| Exact Mass | 259.27 |
| IUPAC Name | 2-ethyl-1-nonylpiperidine;hydrofluoride |
| SMILES | CCCCCCCCCN1CCCCC1CC.F |
| InChI | InChI=1S/C16H33N.FH/c1-3-5-6-7-8-9-11-14-17-15-12-10-13-16(17)4-2;/h16H,3-15H2,1-2H3;1H |
| InChIKey | HXBCIBXDJCJDNR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1-nonylpiperidine;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-nonylpiperidine;hydrofluoride?
The IUPAC name of 2-ethyl-1-nonylpiperidine;hydrofluoride (CID 175849535) is 2-ethyl-1-nonylpiperidine;hydrofluoride.
What is the SMILES notation for 2-ethyl-1-nonylpiperidine;hydrofluoride?
The canonical SMILES for 2-ethyl-1-nonylpiperidine;hydrofluoride is CCCCCCCCCN1CCCCC1CC.F.
What is the InChIKey of 2-ethyl-1-nonylpiperidine;hydrofluoride?
The InChIKey is HXBCIBXDJCJDNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33N.FH/c1-3-5-6-7-8-9-11-14-17-15-12-10-13-16(17)4-2;/h16H,3-15H2,1-2H3;1H.
What are the key properties of 2-ethyl-1-nonylpiperidine;hydrofluoride?
2-ethyl-1-nonylpiperidine;hydrofluoride has a molecular weight of 259.45 g/mol, XLogP of 5.15, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-nonylpiperidine;hydrofluoride is sourced from PubChem (CID 175849535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).