C18H16FN5O2S — CID 175849886
(2R)-2-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)-(6-fluoro-3-pyridinyl)amino]propanamide (PubChem CID 175849886) has the molecular formula C18H16FN5O2S and a molecular weight of 385.42 g/mol. Its IUPAC name is (2R)-2-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)-(6-fluoro-3-pyridinyl)amino]propanamide.
| Compound Name | (2R)-2-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)-(6-fluoro-3-pyridinyl)amino]propanamide |
|---|---|
| PubChem CID | 175849886 |
| Molecular Formula | C18H16FN5O2S |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (2R)-2-[(4-amino-5-benzoyl-1,3-thiazol-2-yl)-(6-fluoro-3-pyridinyl)amino]propanamide |
| SMILES | C[C@H](C(N)=O)N(c1ccc(F)nc1)c1nc(N)c(C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C18H16FN5O2S/c1-10(17(21)26)24(12-7-8-13(19)22-9-12)18-23-16(20)15(27-18)14(25)11-5-3-2-4-6-11/h2-10H,20H2,1H3,(H2,21,26)/t10-/m1/s1 |
| InChIKey | URUACJKEKBTLEI-SNVBAGLBSA-N |
| XLogP | 2.50 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|