About azane;chloro-[[[chloromethyl(dimethyl)silyl]amino]-dimethylsilyl]methane
azane;chloro-[[[chloromethyl(dimethyl)silyl]amino]-dimethylsilyl]methane (PubChem CID 175850410) has the molecular formula C6H20Cl2N2Si2
and a molecular weight of 247.32 g/mol. Its IUPAC name is azane;chloro-[[[chloromethyl(dimethyl)silyl]amino]-dimethylsilyl]methane.
Molecular Properties
| Compound Name | azane;chloro-[[[chloromethyl(dimethyl)silyl]amino]-dimethylsilyl]methane |
| PubChem CID | 175850410 |
| Molecular Formula | C6H20Cl2N2Si2 |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | azane;chloro-[[[chloromethyl(dimethyl)silyl]amino]-dimethylsilyl]methane |
| SMILES | C[Si](C)(CCl)N[Si](C)(C)CCl.N |
| InChI | InChI=1S/C6H17Cl2NSi2.H3N/c1-10(2,5-7)9-11(3,4)6-8;/h9H,5-6H2,1-4H3;1H3 |
| InChIKey | ALFOBKOHEITVQO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 47.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azane;chloro-[[[chloromethyl(dimethyl)silyl]amino]-dimethylsilyl]methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;chloro-[[[chloromethyl(dimethyl)silyl]amino]-dimethylsilyl]methane?
The IUPAC name of azane;chloro-[[[chloromethyl(dimethyl)silyl]amino]-dimethylsilyl]methane (CID 175850410) is azane;chloro-[[[chloromethyl(dimethyl)silyl]amino]-dimethylsilyl]methane.
What is the SMILES notation for azane;chloro-[[[chloromethyl(dimethyl)silyl]amino]-dimethylsilyl]methane?
The canonical SMILES for azane;chloro-[[[chloromethyl(dimethyl)silyl]amino]-dimethylsilyl]methane is C[Si](C)(CCl)N[Si](C)(C)CCl.N.
What is the InChIKey of azane;chloro-[[[chloromethyl(dimethyl)silyl]amino]-dimethylsilyl]methane?
The InChIKey is ALFOBKOHEITVQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H17Cl2NSi2.H3N/c1-10(2,5-7)9-11(3,4)6-8;/h9H,5-6H2,1-4H3;1H3.
What are the key properties of azane;chloro-[[[chloromethyl(dimethyl)silyl]amino]-dimethylsilyl]methane?
azane;chloro-[[[chloromethyl(dimethyl)silyl]amino]-dimethylsilyl]methane has a molecular weight of 247.32 g/mol, XLogP of 2.70, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;chloro-[[[chloromethyl(dimethyl)silyl]amino]-dimethylsilyl]methane is sourced from PubChem (CID 175850410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).