About [5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl] 4-chloro-2-phenylbenzenesulfonate
[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl] 4-chloro-2-phenylbenzenesulfonate (PubChem CID 175850526) has the molecular formula C22H13Cl3F3NO4S
and a molecular weight of 550.77 g/mol. Its IUPAC name is [5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl] 4-chloro-2-phenylbenzenesulfonate.
Molecular Properties
| Compound Name | [5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl] 4-chloro-2-phenylbenzenesulfonate |
| PubChem CID | 175850526 |
| Molecular Formula | C22H13Cl3F3NO4S |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 548.96 |
| IUPAC Name | [5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl] 4-chloro-2-phenylbenzenesulfonate |
| SMILES | O=S(=O)(OC1=NOC(c2cc(Cl)cc(Cl)c2)(C(F)(F)F)C1)c1ccc(Cl)cc1-c1ccccc1 |
| InChI | InChI=1S/C22H13Cl3F3NO4S/c23-15-6-7-19(18(11-15)13-4-2-1-3-5-13)34(30,31)32-20-12-21(33-29-20,22(26,27)28)14-8-16(24)10-17(25)9-14/h1-11H,12H2 |
| InChIKey | BMXOBPSMUPVPBU-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl] 4-chloro-2-phenylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl] 4-chloro-2-phenylbenzenesulfonate?
The IUPAC name of [5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl] 4-chloro-2-phenylbenzenesulfonate (CID 175850526) is [5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl] 4-chloro-2-phenylbenzenesulfonate.
What is the SMILES notation for [5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl] 4-chloro-2-phenylbenzenesulfonate?
The canonical SMILES for [5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl] 4-chloro-2-phenylbenzenesulfonate is O=S(=O)(OC1=NOC(c2cc(Cl)cc(Cl)c2)(C(F)(F)F)C1)c1ccc(Cl)cc1-c1ccccc1.
What is the InChIKey of [5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl] 4-chloro-2-phenylbenzenesulfonate?
The InChIKey is BMXOBPSMUPVPBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13Cl3F3NO4S/c23-15-6-7-19(18(11-15)13-4-2-1-3-5-13)34(30,31)32-20-12-21(33-29-20,22(26,27)28)14-8-16(24)10-17(25)9-14/h1-11H,12H2.
What are the key properties of [5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl] 4-chloro-2-phenylbenzenesulfonate?
[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl] 4-chloro-2-phenylbenzenesulfonate has a molecular weight of 550.77 g/mol, XLogP of 7.21, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl] 4-chloro-2-phenylbenzenesulfonate is sourced from PubChem (CID 175850526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).