About 1-cyclopenta-2,4-dien-1-yl-9H-fluorene;iron(3+);trihexafluorophosphate
1-cyclopenta-2,4-dien-1-yl-9H-fluorene;iron(3+);trihexafluorophosphate (PubChem CID 175851638) has the molecular formula C18H14F18FeP3
and a molecular weight of 721.04 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-yl-9H-fluorene;iron(3+);trihexafluorophosphate.
Molecular Properties
| Compound Name | 1-cyclopenta-2,4-dien-1-yl-9H-fluorene;iron(3+);trihexafluorophosphate |
| PubChem CID | 175851638 |
| Molecular Formula | C18H14F18FeP3 |
| Molecular Weight | 721.04 g/mol |
| Exact Mass | 720.94 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-yl-9H-fluorene;iron(3+);trihexafluorophosphate |
| SMILES | C1=CC(c2cccc3c2Cc2ccccc2-3)C=C1.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F.[Fe+3] |
| InChI | InChI=1S/C18H14.3F6P.Fe/c1-2-7-13(6-1)15-10-5-11-17-16-9-4-3-8-14(16)12-18(15)17;3*1-7(2,3,4,5)6;/h1-11,13H,12H2;;;;/q;3*-1;+3 |
| InChIKey | QLHCIWNXXQUUII-UHFFFAOYSA-N |
| XLogP | 14.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 721.04 |
| LogP ≤ 5 | 14.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopenta-2,4-dien-1-yl-9H-fluorene;iron(3+);trihexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-2,4-dien-1-yl-9H-fluorene;iron(3+);trihexafluorophosphate?
The IUPAC name of 1-cyclopenta-2,4-dien-1-yl-9H-fluorene;iron(3+);trihexafluorophosphate (CID 175851638) is 1-cyclopenta-2,4-dien-1-yl-9H-fluorene;iron(3+);trihexafluorophosphate.
What is the SMILES notation for 1-cyclopenta-2,4-dien-1-yl-9H-fluorene;iron(3+);trihexafluorophosphate?
The canonical SMILES for 1-cyclopenta-2,4-dien-1-yl-9H-fluorene;iron(3+);trihexafluorophosphate is C1=CC(c2cccc3c2Cc2ccccc2-3)C=C1.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F.[Fe+3].
What is the InChIKey of 1-cyclopenta-2,4-dien-1-yl-9H-fluorene;iron(3+);trihexafluorophosphate?
The InChIKey is QLHCIWNXXQUUII-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14.3F6P.Fe/c1-2-7-13(6-1)15-10-5-11-17-16-9-4-3-8-14(16)12-18(15)17;3*1-7(2,3,4,5)6;/h1-11,13H,12H2;;;;/q;3*-1;+3.
What are the key properties of 1-cyclopenta-2,4-dien-1-yl-9H-fluorene;iron(3+);trihexafluorophosphate?
1-cyclopenta-2,4-dien-1-yl-9H-fluorene;iron(3+);trihexafluorophosphate has a molecular weight of 721.04 g/mol, XLogP of 14.61, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-2,4-dien-1-yl-9H-fluorene;iron(3+);trihexafluorophosphate is sourced from PubChem (CID 175851638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).