About 1H-imidazol-2-yl(1,3-thiazol-5-yl)methanol
1H-imidazol-2-yl(1,3-thiazol-5-yl)methanol (PubChem CID 175852898) has the molecular formula C7H7N3OS
and a molecular weight of 181.22 g/mol. Its IUPAC name is 1H-imidazol-2-yl(1,3-thiazol-5-yl)methanol.
Molecular Properties
| Compound Name | 1H-imidazol-2-yl(1,3-thiazol-5-yl)methanol |
| PubChem CID | 175852898 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 1H-imidazol-2-yl(1,3-thiazol-5-yl)methanol |
| SMILES | OC(c1ncc[nH]1)c1cncs1 |
| InChI | InChI=1S/C7H7N3OS/c11-6(5-3-8-4-12-5)7-9-1-2-10-7/h1-4,6,11H,(H,9,10) |
| InChIKey | GJXCXSABELRVAW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-imidazol-2-yl(1,3-thiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazol-2-yl(1,3-thiazol-5-yl)methanol?
The IUPAC name of 1H-imidazol-2-yl(1,3-thiazol-5-yl)methanol (CID 175852898) is 1H-imidazol-2-yl(1,3-thiazol-5-yl)methanol.
What is the SMILES notation for 1H-imidazol-2-yl(1,3-thiazol-5-yl)methanol?
The canonical SMILES for 1H-imidazol-2-yl(1,3-thiazol-5-yl)methanol is OC(c1ncc[nH]1)c1cncs1.
What is the InChIKey of 1H-imidazol-2-yl(1,3-thiazol-5-yl)methanol?
The InChIKey is GJXCXSABELRVAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3OS/c11-6(5-3-8-4-12-5)7-9-1-2-10-7/h1-4,6,11H,(H,9,10).
What are the key properties of 1H-imidazol-2-yl(1,3-thiazol-5-yl)methanol?
1H-imidazol-2-yl(1,3-thiazol-5-yl)methanol has a molecular weight of 181.22 g/mol, XLogP of 0.95, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazol-2-yl(1,3-thiazol-5-yl)methanol is sourced from PubChem (CID 175852898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).