C20H25F3N4O4 — CID 175853878
ethyl 1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate;ethyl 1-(2,2,2-trifluoroethyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-5-carboxylate (PubChem CID 175853878) has the molecular formula C20H25F3N4O4 and a molecular weight of 442.44 g/mol. Its IUPAC name is ethyl 1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate;ethyl 1-(2,2,2-trifluoroethyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-5-carboxylate.
| Compound Name | ethyl 1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate;ethyl 1-(2,2,2-trifluoroethyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 175853878 |
| Molecular Formula | C20H25F3N4O4 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | ethyl 1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate;ethyl 1-(2,2,2-trifluoroethyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-5-carboxylate |
| SMILES | CCOC(=O)C1Cc2cn[nH]c2C1.CCOC(=O)C1Cc2cnn(CC(F)(F)F)c2C1 |
| InChI | InChI=1S/C11H13F3N2O2.C9H12N2O2/c1-2-18-10(17)7-3-8-5-15-16(9(8)4-7)6-11(12,13)14;1-2-13-9(12)6-3-7-5-10-11-8(7)4-6/h5,7H,2-4,6H2,1H3;5-6H,2-4H2,1H3,(H,10,11) |
| InChIKey | CFXFIWVYHBMNKK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |