About morpholin-4-yl-(2-pyrazin-2-yl-1,3-thiazol-5-yl)methanone
morpholin-4-yl-(2-pyrazin-2-yl-1,3-thiazol-5-yl)methanone (PubChem CID 175854470) has the molecular formula C12H12N4O2S
and a molecular weight of 276.32 g/mol. Its IUPAC name is morpholin-4-yl-(2-pyrazin-2-yl-1,3-thiazol-5-yl)methanone.
Molecular Properties
| Compound Name | morpholin-4-yl-(2-pyrazin-2-yl-1,3-thiazol-5-yl)methanone |
| PubChem CID | 175854470 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | morpholin-4-yl-(2-pyrazin-2-yl-1,3-thiazol-5-yl)methanone |
| SMILES | O=C(c1cnc(-c2cnccn2)s1)N1CCOCC1 |
| InChI | InChI=1S/C12H12N4O2S/c17-12(16-3-5-18-6-4-16)10-8-15-11(19-10)9-7-13-1-2-14-9/h1-2,7-8H,3-6H2 |
| InChIKey | DLMXRWUWSKEETM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze morpholin-4-yl-(2-pyrazin-2-yl-1,3-thiazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-4-yl-(2-pyrazin-2-yl-1,3-thiazol-5-yl)methanone?
The IUPAC name of morpholin-4-yl-(2-pyrazin-2-yl-1,3-thiazol-5-yl)methanone (CID 175854470) is morpholin-4-yl-(2-pyrazin-2-yl-1,3-thiazol-5-yl)methanone.
What is the SMILES notation for morpholin-4-yl-(2-pyrazin-2-yl-1,3-thiazol-5-yl)methanone?
The canonical SMILES for morpholin-4-yl-(2-pyrazin-2-yl-1,3-thiazol-5-yl)methanone is O=C(c1cnc(-c2cnccn2)s1)N1CCOCC1.
What is the InChIKey of morpholin-4-yl-(2-pyrazin-2-yl-1,3-thiazol-5-yl)methanone?
The InChIKey is DLMXRWUWSKEETM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O2S/c17-12(16-3-5-18-6-4-16)10-8-15-11(19-10)9-7-13-1-2-14-9/h1-2,7-8H,3-6H2.
What are the key properties of morpholin-4-yl-(2-pyrazin-2-yl-1,3-thiazol-5-yl)methanone?
morpholin-4-yl-(2-pyrazin-2-yl-1,3-thiazol-5-yl)methanone has a molecular weight of 276.32 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-yl-(2-pyrazin-2-yl-1,3-thiazol-5-yl)methanone is sourced from PubChem (CID 175854470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).