About 2-sulfanyl-1,3,8-triazaspiro[4.5]decan-4-one
2-sulfanyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 175854688) has the molecular formula C7H13N3OS
and a molecular weight of 187.27 g/mol. Its IUPAC name is 2-sulfanyl-1,3,8-triazaspiro[4.5]decan-4-one.
Molecular Properties
| Compound Name | 2-sulfanyl-1,3,8-triazaspiro[4.5]decan-4-one |
| PubChem CID | 175854688 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-sulfanyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | O=C1NC(S)NC12CCNCC2 |
| InChI | InChI=1S/C7H13N3OS/c11-5-7(10-6(12)9-5)1-3-8-4-2-7/h6,8,10,12H,1-4H2,(H,9,11) |
| InChIKey | FMVWEBQSYDENND-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanyl-1,3,8-triazaspiro[4.5]decan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanyl-1,3,8-triazaspiro[4.5]decan-4-one?
The IUPAC name of 2-sulfanyl-1,3,8-triazaspiro[4.5]decan-4-one (CID 175854688) is 2-sulfanyl-1,3,8-triazaspiro[4.5]decan-4-one.
What is the SMILES notation for 2-sulfanyl-1,3,8-triazaspiro[4.5]decan-4-one?
The canonical SMILES for 2-sulfanyl-1,3,8-triazaspiro[4.5]decan-4-one is O=C1NC(S)NC12CCNCC2.
What is the InChIKey of 2-sulfanyl-1,3,8-triazaspiro[4.5]decan-4-one?
The InChIKey is FMVWEBQSYDENND-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3OS/c11-5-7(10-6(12)9-5)1-3-8-4-2-7/h6,8,10,12H,1-4H2,(H,9,11).
What are the key properties of 2-sulfanyl-1,3,8-triazaspiro[4.5]decan-4-one?
2-sulfanyl-1,3,8-triazaspiro[4.5]decan-4-one has a molecular weight of 187.27 g/mol, XLogP of -0.96, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanyl-1,3,8-triazaspiro[4.5]decan-4-one is sourced from PubChem (CID 175854688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).