About 2-chloro-1-(2,3-dideuterio-5H-chromen-7-yl)propan-1-one
2-chloro-1-(2,3-dideuterio-5H-chromen-7-yl)propan-1-one (PubChem CID 175855067) has the molecular formula C12H11ClO2
and a molecular weight of 224.68 g/mol. Its IUPAC name is 2-chloro-1-(2,3-dideuterio-5H-chromen-7-yl)propan-1-one.
Molecular Properties
| Compound Name | 2-chloro-1-(2,3-dideuterio-5H-chromen-7-yl)propan-1-one |
| PubChem CID | 175855067 |
| Molecular Formula | C12H11ClO2 |
| Molecular Weight | 224.68 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-chloro-1-(2,3-dideuterio-5H-chromen-7-yl)propan-1-one |
| SMILES | [2H]C1=C([2H])OC2=CC(C(=O)C(C)Cl)=CCC2=C1 |
| InChI | InChI=1S/C12H11ClO2/c1-8(13)12(14)10-5-4-9-3-2-6-15-11(9)7-10/h2-3,5-8H,4H2,1H3/i2D,6D |
| InChIKey | VLJNUUNEHOLCMX-ZJTJSSCZSA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.68 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-(2,3-dideuterio-5H-chromen-7-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-(2,3-dideuterio-5H-chromen-7-yl)propan-1-one?
The IUPAC name of 2-chloro-1-(2,3-dideuterio-5H-chromen-7-yl)propan-1-one (CID 175855067) is 2-chloro-1-(2,3-dideuterio-5H-chromen-7-yl)propan-1-one.
What is the SMILES notation for 2-chloro-1-(2,3-dideuterio-5H-chromen-7-yl)propan-1-one?
The canonical SMILES for 2-chloro-1-(2,3-dideuterio-5H-chromen-7-yl)propan-1-one is [2H]C1=C([2H])OC2=CC(C(=O)C(C)Cl)=CCC2=C1.
What is the InChIKey of 2-chloro-1-(2,3-dideuterio-5H-chromen-7-yl)propan-1-one?
The InChIKey is VLJNUUNEHOLCMX-ZJTJSSCZSA-N. The full InChI is InChI=1S/C12H11ClO2/c1-8(13)12(14)10-5-4-9-3-2-6-15-11(9)7-10/h2-3,5-8H,4H2,1H3/i2D,6D.
What are the key properties of 2-chloro-1-(2,3-dideuterio-5H-chromen-7-yl)propan-1-one?
2-chloro-1-(2,3-dideuterio-5H-chromen-7-yl)propan-1-one has a molecular weight of 224.68 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-(2,3-dideuterio-5H-chromen-7-yl)propan-1-one is sourced from PubChem (CID 175855067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).