C14H15F3N4O2 — CID 175855323
3-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-6-methyl-[1,2,4]triazolo[4,3-a]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 175855323) has the molecular formula C14H15F3N4O2 and a molecular weight of 328.29 g/mol. Its IUPAC name is 3-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-6-methyl-[1,2,4]triazolo[4,3-a]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-6-methyl-[1,2,4]triazolo[4,3-a]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175855323 |
| Molecular Formula | C14H15F3N4O2 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 3-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-6-methyl-[1,2,4]triazolo[4,3-a]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc2nnc(C3[C@H]4CNC[C@@H]34)n2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H14N4.C2HF3O2/c1-7-2-3-10-14-15-12(16(10)6-7)11-8-4-13-5-9(8)11;3-2(4,5)1(6)7/h2-3,6,8-9,11,13H,4-5H2,1H3;(H,6,7)/t8-,9+,11?; |
| InChIKey | SCQANGVFZDPPOW-WJXUPBHSSA-N |
| XLogP | 1.60 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |