About 6-heptan-3-yl-1,2-dihydropyrimidin-2-amine
6-heptan-3-yl-1,2-dihydropyrimidin-2-amine (PubChem CID 175855411) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is 6-heptan-3-yl-1,2-dihydropyrimidin-2-amine.
Molecular Properties
| Compound Name | 6-heptan-3-yl-1,2-dihydropyrimidin-2-amine |
| PubChem CID | 175855411 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 6-heptan-3-yl-1,2-dihydropyrimidin-2-amine |
| SMILES | CCCCC(CC)C1=CC=NC(N)N1 |
| InChI | InChI=1S/C11H21N3/c1-3-5-6-9(4-2)10-7-8-13-11(12)14-10/h7-9,11,14H,3-6,12H2,1-2H3 |
| InChIKey | GQHWMPGQKHEOFT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-heptan-3-yl-1,2-dihydropyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-heptan-3-yl-1,2-dihydropyrimidin-2-amine?
The IUPAC name of 6-heptan-3-yl-1,2-dihydropyrimidin-2-amine (CID 175855411) is 6-heptan-3-yl-1,2-dihydropyrimidin-2-amine.
What is the SMILES notation for 6-heptan-3-yl-1,2-dihydropyrimidin-2-amine?
The canonical SMILES for 6-heptan-3-yl-1,2-dihydropyrimidin-2-amine is CCCCC(CC)C1=CC=NC(N)N1.
What is the InChIKey of 6-heptan-3-yl-1,2-dihydropyrimidin-2-amine?
The InChIKey is GQHWMPGQKHEOFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3/c1-3-5-6-9(4-2)10-7-8-13-11(12)14-10/h7-9,11,14H,3-6,12H2,1-2H3.
What are the key properties of 6-heptan-3-yl-1,2-dihydropyrimidin-2-amine?
6-heptan-3-yl-1,2-dihydropyrimidin-2-amine has a molecular weight of 195.31 g/mol, XLogP of 2.00, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-heptan-3-yl-1,2-dihydropyrimidin-2-amine is sourced from PubChem (CID 175855411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).