C15H26O2 — CID 175856692
cyclohexyl-(1-hydroxy-2,3-dimethylcyclohexyl)methanone (PubChem CID 175856692) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is cyclohexyl-(1-hydroxy-2,3-dimethylcyclohexyl)methanone.
| Compound Name | cyclohexyl-(1-hydroxy-2,3-dimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 175856692 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | cyclohexyl-(1-hydroxy-2,3-dimethylcyclohexyl)methanone |
| SMILES | CC1CCCC(O)(C(=O)C2CCCCC2)C1C |
| InChI | InChI=1S/C15H26O2/c1-11-7-6-10-15(17,12(11)2)14(16)13-8-4-3-5-9-13/h11-13,17H,3-10H2,1-2H3 |
| InChIKey | SGQAACGIWYXNDT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |