About 4-[(R)-(4-oxo-6-phenyl-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzonitrile
4-[(R)-(4-oxo-6-phenyl-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzonitrile (PubChem CID 175856879) has the molecular formula C28H20N2O3
and a molecular weight of 432.48 g/mol. Its IUPAC name is 4-[(R)-(4-oxo-6-phenyl-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(R)-(4-oxo-6-phenyl-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzonitrile |
| PubChem CID | 175856879 |
| Molecular Formula | C28H20N2O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 4-[(R)-(4-oxo-6-phenyl-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzonitrile |
| SMILES | N#Cc1ccc([C@@H](Oc2cc3c(cc2-c2ccccc2)C(=O)CCO3)c2ccncc2)cc1 |
| InChI | InChI=1S/C28H20N2O3/c29-18-19-6-8-21(9-7-19)28(22-10-13-30-14-11-22)33-27-17-26-24(25(31)12-15-32-26)16-23(27)20-4-2-1-3-5-20/h1-11,13-14,16-17,28H,12,15H2/t28-/m1/s1 |
| InChIKey | IJMIDYXINRDHHI-MUUNZHRXSA-N |
| XLogP | 5.75 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(R)-(4-oxo-6-phenyl-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(R)-(4-oxo-6-phenyl-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzonitrile?
The IUPAC name of 4-[(R)-(4-oxo-6-phenyl-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzonitrile (CID 175856879) is 4-[(R)-(4-oxo-6-phenyl-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzonitrile.
What is the SMILES notation for 4-[(R)-(4-oxo-6-phenyl-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzonitrile?
The canonical SMILES for 4-[(R)-(4-oxo-6-phenyl-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzonitrile is N#Cc1ccc([C@@H](Oc2cc3c(cc2-c2ccccc2)C(=O)CCO3)c2ccncc2)cc1.
What is the InChIKey of 4-[(R)-(4-oxo-6-phenyl-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzonitrile?
The InChIKey is IJMIDYXINRDHHI-MUUNZHRXSA-N. The full InChI is InChI=1S/C28H20N2O3/c29-18-19-6-8-21(9-7-19)28(22-10-13-30-14-11-22)33-27-17-26-24(25(31)12-15-32-26)16-23(27)20-4-2-1-3-5-20/h1-11,13-14,16-17,28H,12,15H2/t28-/m1/s1.
What are the key properties of 4-[(R)-(4-oxo-6-phenyl-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzonitrile?
4-[(R)-(4-oxo-6-phenyl-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzonitrile has a molecular weight of 432.48 g/mol, XLogP of 5.75, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(R)-(4-oxo-6-phenyl-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzonitrile is sourced from PubChem (CID 175856879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).