C21H25N3O3 — CID 175857012
9-cyclohexyl-4,4-dimethyl-2,6,9-triazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),12,14-triene-5,8,10-trione (PubChem CID 175857012) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 9-cyclohexyl-4,4-dimethyl-2,6,9-triazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),12,14-triene-5,8,10-trione.
| Compound Name | 9-cyclohexyl-4,4-dimethyl-2,6,9-triazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),12,14-triene-5,8,10-trione |
|---|---|
| PubChem CID | 175857012 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 9-cyclohexyl-4,4-dimethyl-2,6,9-triazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),12,14-triene-5,8,10-trione |
| SMILES | CC1(C)CN2c3ccccc3C3C(=O)N(C4CCCCC4)C(=O)C3N2C1=O |
| InChI | InChI=1S/C21H25N3O3/c1-21(2)12-22-15-11-7-6-10-14(15)16-17(24(22)20(21)27)19(26)23(18(16)25)13-8-4-3-5-9-13/h6-7,10-11,13,16-17H,3-5,8-9,12H2,1-2H3 |
| InChIKey | XEPVIBDZYCRTBR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|