C22H39FN4O — CID 175857183
(6R,14S)-9-fluoro-14-methyl-3-oxa-2,17,21,25-tetrazapentacyclo[16.6.2.02,6.07,12.022,26]hexacosane (PubChem CID 175857183) has the molecular formula C22H39FN4O and a molecular weight of 394.58 g/mol. Its IUPAC name is (6R,14S)-9-fluoro-14-methyl-3-oxa-2,17,21,25-tetrazapentacyclo[16.6.2.02,6.07,12.022,26]hexacosane.
| Compound Name | (6R,14S)-9-fluoro-14-methyl-3-oxa-2,17,21,25-tetrazapentacyclo[16.6.2.02,6.07,12.022,26]hexacosane |
|---|---|
| PubChem CID | 175857183 |
| Molecular Formula | C22H39FN4O |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | (6R,14S)-9-fluoro-14-methyl-3-oxa-2,17,21,25-tetrazapentacyclo[16.6.2.02,6.07,12.022,26]hexacosane |
| SMILES | C[C@@H]1CCNC2CCNC3CCC(NC23)N2OCC[C@@H]2C2CC(F)CCC2C1 |
| InChI | InChI=1S/C22H39FN4O/c1-14-6-9-24-19-7-10-25-18-4-5-21(26-22(18)19)27-20(8-11-28-27)17-13-16(23)3-2-15(17)12-14/h14-22,24-26H,2-13H2,1H3/t14-,15?,16?,17?,18?,19?,20-,21?,22?/m1/s1 |
| InChIKey | VUICVNRQNJRGAB-UOIWAFJHSA-N |
| XLogP | 2.57 |
| TPSA | 48.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |