C26H29F3N5O7P — CID 175857897
N-[(7R)-4-[(3R,5S)-3-amino-2-hydroxy-5-methylpiperidin-1-yl]-7-hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide;phosphoric acid (PubChem CID 175857897) has the molecular formula C26H29F3N5O7P and a molecular weight of 611.51 g/mol. Its IUPAC name is N-[(7R)-4-[(3R,5S)-3-amino-2-hydroxy-5-methylpiperidin-1-yl]-7-hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide;phosphoric acid.
| Compound Name | N-[(7R)-4-[(3R,5S)-3-amino-2-hydroxy-5-methylpiperidin-1-yl]-7-hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide;phosphoric acid |
|---|---|
| PubChem CID | 175857897 |
| Molecular Formula | C26H29F3N5O7P |
| Molecular Weight | 611.51 g/mol |
| Exact Mass | 611.18 |
| IUPAC Name | N-[(7R)-4-[(3R,5S)-3-amino-2-hydroxy-5-methylpiperidin-1-yl]-7-hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide;phosphoric acid |
| SMILES | C[C@H]1C[C@@H](N)C(O)N(c2c(NC(=O)c3ccc(F)c(-c4c(F)cccc4F)n3)cnc3c2CC[C@H]3O)C1.O=P(O)(O)O |
| InChI | InChI=1S/C26H26F3N5O3.H3O4P/c1-12-9-17(30)26(37)34(11-12)24-13-5-8-20(35)22(13)31-10-19(24)33-25(36)18-7-6-16(29)23(32-18)21-14(27)3-2-4-15(21)28;1-5(2,3)4/h2-4,6-7,10,12,17,20,26,35,37H,5,8-9,11,30H2,1H3,(H,33,36);(H3,1,2,3,4)/t12-,17+,20+,26?;/m0./s1 |
| InChIKey | VSWRGICFZDNXFT-NZTJZHKOSA-N |
| XLogP | 2.36 |
| TPSA | 202.36 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|