C37H39N5O4 — CID 175858158
3-[3-methyl-5-[1-[2-[4-(2-naphthalen-1-ylethynyl)piperidin-1-yl]-2-oxoethyl]piperidin-4-yl]-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 175858158) has the molecular formula C37H39N5O4 and a molecular weight of 617.75 g/mol. Its IUPAC name is 3-[3-methyl-5-[1-[2-[4-(2-naphthalen-1-ylethynyl)piperidin-1-yl]-2-oxoethyl]piperidin-4-yl]-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-methyl-5-[1-[2-[4-(2-naphthalen-1-ylethynyl)piperidin-1-yl]-2-oxoethyl]piperidin-4-yl]-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175858158 |
| Molecular Formula | C37H39N5O4 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.30 |
| IUPAC Name | 3-[3-methyl-5-[1-[2-[4-(2-naphthalen-1-ylethynyl)piperidin-1-yl]-2-oxoethyl]piperidin-4-yl]-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(C3CCN(CC(=O)N4CCC(C#Cc5cccc6ccccc56)CC4)CC3)cc21 |
| InChI | InChI=1S/C37H39N5O4/c1-39-33-23-29(11-12-31(33)42(37(39)46)32-13-14-34(43)38-36(32)45)26-17-19-40(20-18-26)24-35(44)41-21-15-25(16-22-41)9-10-28-7-4-6-27-5-2-3-8-30(27)28/h2-8,11-12,23,25-26,32H,13-22,24H2,1H3,(H,38,43,45) |
| InChIKey | LMWCKXBBIQAFMQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 96.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|