About 1-(1-aminoethylideneamino)ethylideneazanium;nickel(2+)
1-(1-aminoethylideneamino)ethylideneazanium;nickel(2+) (PubChem CID 175858505) has the molecular formula C4H10N3Ni+3
and a molecular weight of 158.84 g/mol. Its IUPAC name is 1-(1-aminoethylideneamino)ethylideneazanium;nickel(2+).
Molecular Properties
| Compound Name | 1-(1-aminoethylideneamino)ethylideneazanium;nickel(2+) |
| PubChem CID | 175858505 |
| Molecular Formula | C4H10N3Ni+3 |
| Molecular Weight | 158.84 g/mol |
| Exact Mass | 158.02 |
| IUPAC Name | 1-(1-aminoethylideneamino)ethylideneazanium;nickel(2+) |
| SMILES | CC(=[NH2+])/N=C(\C)N.[Ni+2] |
| InChI | InChI=1S/C4H9N3.Ni/c1-3(5)7-4(2)6;/h1-2H3,(H3,5,6,7);/q;+2/p+1 |
| InChIKey | JESYQSBIPQSMMM-UHFFFAOYSA-O |
| XLogP | -1.46 |
| TPSA | 63.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.84 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-aminoethylideneamino)ethylideneazanium;nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-aminoethylideneamino)ethylideneazanium;nickel(2+)?
The IUPAC name of 1-(1-aminoethylideneamino)ethylideneazanium;nickel(2+) (CID 175858505) is 1-(1-aminoethylideneamino)ethylideneazanium;nickel(2+).
What is the SMILES notation for 1-(1-aminoethylideneamino)ethylideneazanium;nickel(2+)?
The canonical SMILES for 1-(1-aminoethylideneamino)ethylideneazanium;nickel(2+) is CC(=[NH2+])/N=C(\C)N.[Ni+2].
What is the InChIKey of 1-(1-aminoethylideneamino)ethylideneazanium;nickel(2+)?
The InChIKey is JESYQSBIPQSMMM-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H9N3.Ni/c1-3(5)7-4(2)6;/h1-2H3,(H3,5,6,7);/q;+2/p+1.
What are the key properties of 1-(1-aminoethylideneamino)ethylideneazanium;nickel(2+)?
1-(1-aminoethylideneamino)ethylideneazanium;nickel(2+) has a molecular weight of 158.84 g/mol, XLogP of -1.46, 0 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-aminoethylideneamino)ethylideneazanium;nickel(2+) is sourced from PubChem (CID 175858505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).