About (3R)-3-benzyl-1-methylsulfonylpiperazine;2,2,2-trifluoroacetic acid
(3R)-3-benzyl-1-methylsulfonylpiperazine;2,2,2-trifluoroacetic acid (PubChem CID 175858517) has the molecular formula C14H19F3N2O4S
and a molecular weight of 368.38 g/mol. Its IUPAC name is (3R)-3-benzyl-1-methylsulfonylpiperazine;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | (3R)-3-benzyl-1-methylsulfonylpiperazine;2,2,2-trifluoroacetic acid |
| PubChem CID | 175858517 |
| Molecular Formula | C14H19F3N2O4S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (3R)-3-benzyl-1-methylsulfonylpiperazine;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)N1CCN[C@H](Cc2ccccc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H18N2O2S.C2HF3O2/c1-17(15,16)14-8-7-13-12(10-14)9-11-5-3-2-4-6-11;3-2(4,5)1(6)7/h2-6,12-13H,7-10H2,1H3;(H,6,7)/t12-;/m1./s1 |
| InChIKey | GTGXZHGYYILIBI-UTONKHPSSA-N |
| XLogP | 1.10 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-3-benzyl-1-methylsulfonylpiperazine;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-benzyl-1-methylsulfonylpiperazine;2,2,2-trifluoroacetic acid?
The IUPAC name of (3R)-3-benzyl-1-methylsulfonylpiperazine;2,2,2-trifluoroacetic acid (CID 175858517) is (3R)-3-benzyl-1-methylsulfonylpiperazine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for (3R)-3-benzyl-1-methylsulfonylpiperazine;2,2,2-trifluoroacetic acid?
The canonical SMILES for (3R)-3-benzyl-1-methylsulfonylpiperazine;2,2,2-trifluoroacetic acid is CS(=O)(=O)N1CCN[C@H](Cc2ccccc2)C1.O=C(O)C(F)(F)F.
What is the InChIKey of (3R)-3-benzyl-1-methylsulfonylpiperazine;2,2,2-trifluoroacetic acid?
The InChIKey is GTGXZHGYYILIBI-UTONKHPSSA-N. The full InChI is InChI=1S/C12H18N2O2S.C2HF3O2/c1-17(15,16)14-8-7-13-12(10-14)9-11-5-3-2-4-6-11;3-2(4,5)1(6)7/h2-6,12-13H,7-10H2,1H3;(H,6,7)/t12-;/m1./s1.
What are the key properties of (3R)-3-benzyl-1-methylsulfonylpiperazine;2,2,2-trifluoroacetic acid?
(3R)-3-benzyl-1-methylsulfonylpiperazine;2,2,2-trifluoroacetic acid has a molecular weight of 368.38 g/mol, XLogP of 1.10, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-benzyl-1-methylsulfonylpiperazine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 175858517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).