C14H8ClF3N4 — CID 175858931
N-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]quinolin-3-amine (PubChem CID 175858931) has the molecular formula C14H8ClF3N4 and a molecular weight of 324.69 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]quinolin-3-amine.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]quinolin-3-amine |
|---|---|
| PubChem CID | 175858931 |
| Molecular Formula | C14H8ClF3N4 |
| Molecular Weight | 324.69 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]quinolin-3-amine |
| SMILES | FC(F)(F)c1cnc(Cl)nc1Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C14H8ClF3N4/c15-13-20-7-10(14(16,17)18)12(22-13)21-9-5-8-3-1-2-4-11(8)19-6-9/h1-7H,(H,20,21,22) |
| InChIKey | JKTCBXPHTQHVCE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.69 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |