About benzyl 4-pyrrolidin-3-yloxypiperidine-1-carboxylate;2,2,2-trifluoroacetic acid
benzyl 4-pyrrolidin-3-yloxypiperidine-1-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 175859014) has the molecular formula C19H25F3N2O5
and a molecular weight of 418.41 g/mol. Its IUPAC name is benzyl 4-pyrrolidin-3-yloxypiperidine-1-carboxylate;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | benzyl 4-pyrrolidin-3-yloxypiperidine-1-carboxylate;2,2,2-trifluoroacetic acid |
| PubChem CID | 175859014 |
| Molecular Formula | C19H25F3N2O5 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | benzyl 4-pyrrolidin-3-yloxypiperidine-1-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(OCc1ccccc1)N1CCC(OC2CCNC2)CC1 |
| InChI | InChI=1S/C17H24N2O3.C2HF3O2/c20-17(21-13-14-4-2-1-3-5-14)19-10-7-15(8-11-19)22-16-6-9-18-12-16;3-2(4,5)1(6)7/h1-5,15-16,18H,6-13H2;(H,6,7) |
| InChIKey | WHALQZZLRMOLLS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 4-pyrrolidin-3-yloxypiperidine-1-carboxylate;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-pyrrolidin-3-yloxypiperidine-1-carboxylate;2,2,2-trifluoroacetic acid?
The IUPAC name of benzyl 4-pyrrolidin-3-yloxypiperidine-1-carboxylate;2,2,2-trifluoroacetic acid (CID 175859014) is benzyl 4-pyrrolidin-3-yloxypiperidine-1-carboxylate;2,2,2-trifluoroacetic acid.
What is the SMILES notation for benzyl 4-pyrrolidin-3-yloxypiperidine-1-carboxylate;2,2,2-trifluoroacetic acid?
The canonical SMILES for benzyl 4-pyrrolidin-3-yloxypiperidine-1-carboxylate;2,2,2-trifluoroacetic acid is O=C(O)C(F)(F)F.O=C(OCc1ccccc1)N1CCC(OC2CCNC2)CC1.
What is the InChIKey of benzyl 4-pyrrolidin-3-yloxypiperidine-1-carboxylate;2,2,2-trifluoroacetic acid?
The InChIKey is WHALQZZLRMOLLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O3.C2HF3O2/c20-17(21-13-14-4-2-1-3-5-14)19-10-7-15(8-11-19)22-16-6-9-18-12-16;3-2(4,5)1(6)7/h1-5,15-16,18H,6-13H2;(H,6,7).
What are the key properties of benzyl 4-pyrrolidin-3-yloxypiperidine-1-carboxylate;2,2,2-trifluoroacetic acid?
benzyl 4-pyrrolidin-3-yloxypiperidine-1-carboxylate;2,2,2-trifluoroacetic acid has a molecular weight of 418.41 g/mol, XLogP of 2.80, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-pyrrolidin-3-yloxypiperidine-1-carboxylate;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 175859014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).