C21H26FN7O3 — CID 175862296
2-[3-[(3S)-3-tert-butylpiperazin-1-yl]-1,2,4-triazin-6-yl]-4-fluoro-5-(1H-pyrazol-4-yl)phenol;formic acid (PubChem CID 175862296) has the molecular formula C21H26FN7O3 and a molecular weight of 443.48 g/mol. Its IUPAC name is 2-[3-[(3S)-3-tert-butylpiperazin-1-yl]-1,2,4-triazin-6-yl]-4-fluoro-5-(1H-pyrazol-4-yl)phenol;formic acid.
| Compound Name | 2-[3-[(3S)-3-tert-butylpiperazin-1-yl]-1,2,4-triazin-6-yl]-4-fluoro-5-(1H-pyrazol-4-yl)phenol;formic acid |
|---|---|
| PubChem CID | 175862296 |
| Molecular Formula | C21H26FN7O3 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 2-[3-[(3S)-3-tert-butylpiperazin-1-yl]-1,2,4-triazin-6-yl]-4-fluoro-5-(1H-pyrazol-4-yl)phenol;formic acid |
| SMILES | CC(C)(C)[C@H]1CN(c2ncc(-c3cc(F)c(-c4cn[nH]c4)cc3O)nn2)CCN1.O=CO |
| InChI | InChI=1S/C20H24FN7O.CH2O2/c1-20(2,3)18-11-28(5-4-22-18)19-23-10-16(26-27-19)14-6-15(21)13(7-17(14)29)12-8-24-25-9-12;2-1-3/h6-10,18,22,29H,4-5,11H2,1-3H3,(H,24,25);1H,(H,2,3)/t18-;/m1./s1 |
| InChIKey | FDIWYIZMXMFFAL-GMUIIQOCSA-N |
| XLogP | 2.30 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|