C11H14N6 — CID 175862728
1-(1,2,3,4-tetrahydroisoquinolin-7-yl)-1,2,4-triazole-3,5-diamine (PubChem CID 175862728) has the molecular formula C11H14N6 and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydroisoquinolin-7-yl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(1,2,3,4-tetrahydroisoquinolin-7-yl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 175862728 |
| Molecular Formula | C11H14N6 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-(1,2,3,4-tetrahydroisoquinolin-7-yl)-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(N)n(-c2ccc3c(c2)CNCC3)n1 |
| InChI | InChI=1S/C11H14N6/c12-10-15-11(13)17(16-10)9-2-1-7-3-4-14-6-8(7)5-9/h1-2,5,14H,3-4,6H2,(H4,12,13,15,16) |
| InChIKey | PVXHIOOKJSLOKL-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |