C14H12N4O — CID 175863331
2-(1H-indol-4-yl)-7,8-dihydro-6H-pyrimido[5,4-b][1,4]oxazine (PubChem CID 175863331) has the molecular formula C14H12N4O and a molecular weight of 252.28 g/mol. Its IUPAC name is 2-(1H-indol-4-yl)-7,8-dihydro-6H-pyrimido[5,4-b][1,4]oxazine.
| Compound Name | 2-(1H-indol-4-yl)-7,8-dihydro-6H-pyrimido[5,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 175863331 |
| Molecular Formula | C14H12N4O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-(1H-indol-4-yl)-7,8-dihydro-6H-pyrimido[5,4-b][1,4]oxazine |
| SMILES | c1cc(-c2ncc3c(n2)NCCO3)c2cc[nH]c2c1 |
| InChI | InChI=1S/C14H12N4O/c1-2-10(9-4-5-15-11(9)3-1)13-17-8-12-14(18-13)16-6-7-19-12/h1-5,8,15H,6-7H2,(H,16,17,18) |
| InChIKey | NPQYTZNYGRSXDB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |