C20H25N3O — CID 175863441
(3R,12S)-N,N-diethyl-2-methyl-6,11-diazatetracyclo[6.6.1.13,12.05,15]hexadeca-1(15),5,8,10,13-pentaene-13-carboxamide (PubChem CID 175863441) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (3R,12S)-N,N-diethyl-2-methyl-6,11-diazatetracyclo[6.6.1.13,12.05,15]hexadeca-1(15),5,8,10,13-pentaene-13-carboxamide.
| Compound Name | (3R,12S)-N,N-diethyl-2-methyl-6,11-diazatetracyclo[6.6.1.13,12.05,15]hexadeca-1(15),5,8,10,13-pentaene-13-carboxamide |
|---|---|
| PubChem CID | 175863441 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (3R,12S)-N,N-diethyl-2-methyl-6,11-diazatetracyclo[6.6.1.13,12.05,15]hexadeca-1(15),5,8,10,13-pentaene-13-carboxamide |
| SMILES | CCN(CC)C(=O)C1=CC2=C3C4=C/C=N\[C@H]1C[C@H](CC3=NC4)C2C |
| InChI | InChI=1S/C20H25N3O/c1-4-23(5-2)20(24)16-10-15-12(3)14-8-17(16)21-7-6-13-11-22-18(9-14)19(13)15/h6-7,10,12,14,17H,4-5,8-9,11H2,1-3H3/b13-6?,21-7-/t12?,14-,17+/m1/s1 |
| InChIKey | BJPLJIYJTWPJBS-XGZXJOGKSA-N |
| XLogP | 2.97 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |