About 2-[2-(3,3-difluoroazetidin-1-yl)ethyl]triazole-4-carboxamide
2-[2-(3,3-difluoroazetidin-1-yl)ethyl]triazole-4-carboxamide (PubChem CID 175864398) has the molecular formula C8H11F2N5O
and a molecular weight of 231.21 g/mol. Its IUPAC name is 2-[2-(3,3-difluoroazetidin-1-yl)ethyl]triazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-[2-(3,3-difluoroazetidin-1-yl)ethyl]triazole-4-carboxamide |
| PubChem CID | 175864398 |
| Molecular Formula | C8H11F2N5O |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-[2-(3,3-difluoroazetidin-1-yl)ethyl]triazole-4-carboxamide |
| SMILES | NC(=O)c1cnn(CCN2CC(F)(F)C2)n1 |
| InChI | InChI=1S/C8H11F2N5O/c9-8(10)4-14(5-8)1-2-15-12-3-6(13-15)7(11)16/h3H,1-2,4-5H2,(H2,11,16) |
| InChIKey | DDHXNCXTCJQLNY-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(3,3-difluoroazetidin-1-yl)ethyl]triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,3-difluoroazetidin-1-yl)ethyl]triazole-4-carboxamide?
The IUPAC name of 2-[2-(3,3-difluoroazetidin-1-yl)ethyl]triazole-4-carboxamide (CID 175864398) is 2-[2-(3,3-difluoroazetidin-1-yl)ethyl]triazole-4-carboxamide.
What is the SMILES notation for 2-[2-(3,3-difluoroazetidin-1-yl)ethyl]triazole-4-carboxamide?
The canonical SMILES for 2-[2-(3,3-difluoroazetidin-1-yl)ethyl]triazole-4-carboxamide is NC(=O)c1cnn(CCN2CC(F)(F)C2)n1.
What is the InChIKey of 2-[2-(3,3-difluoroazetidin-1-yl)ethyl]triazole-4-carboxamide?
The InChIKey is DDHXNCXTCJQLNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2N5O/c9-8(10)4-14(5-8)1-2-15-12-3-6(13-15)7(11)16/h3H,1-2,4-5H2,(H2,11,16).
What are the key properties of 2-[2-(3,3-difluoroazetidin-1-yl)ethyl]triazole-4-carboxamide?
2-[2-(3,3-difluoroazetidin-1-yl)ethyl]triazole-4-carboxamide has a molecular weight of 231.21 g/mol, XLogP of -0.67, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,3-difluoroazetidin-1-yl)ethyl]triazole-4-carboxamide is sourced from PubChem (CID 175864398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).